C28H33N3O9S — CID 21372862
2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 21372862) has the molecular formula C28H33N3O9S and a molecular weight of 587.65 g/mol. Its IUPAC name is 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 21372862 |
| Molecular Formula | C28H33N3O9S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)CN(c1cc(OC)ccc1OC)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H33N3O9S/c1-36-15-14-29-28(33)21-8-6-7-9-22(21)30-27(32)18-31(23-16-19(37-2)10-12-24(23)38-3)41(34,35)20-11-13-25(39-4)26(17-20)40-5/h6-13,16-17H,14-15,18H2,1-5H3,(H,29,33)(H,30,32) |
| InChIKey | ZOPSHLPJGAGPED-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|