C21H27N3O7S — CID 2957888
2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 2957888) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 2957888 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)CN(c1cc(OC)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C21H27N3O7S/c1-29-12-11-22-21(26)16-7-5-6-8-17(16)23-20(25)14-24(32(4,27)28)18-13-15(30-2)9-10-19(18)31-3/h5-10,13H,11-12,14H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | YLVSLCYOWWLRAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|