C18H21FN2O5S — CID 113070787
N-[2-(2,5-dimethoxy-N-methylsulfonylanilino)ethyl]-2-fluorobenzamide (PubChem CID 113070787) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxy-N-methylsulfonylanilino)ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(2,5-dimethoxy-N-methylsulfonylanilino)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 113070787 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-(2,5-dimethoxy-N-methylsulfonylanilino)ethyl]-2-fluorobenzamide |
| SMILES | COc1ccc(OC)c(N(CCNC(=O)c2ccccc2F)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-25-13-8-9-17(26-2)16(12-13)21(27(3,23)24)11-10-20-18(22)14-6-4-5-7-15(14)19/h4-9,12H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | ZKEBBMGISIKYSW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |