C26H26FN3O6S — CID 43899862
2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 43899862) has the molecular formula C26H26FN3O6S and a molecular weight of 527.57 g/mol. Its IUPAC name is 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 43899862 |
| Molecular Formula | C26H26FN3O6S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2-fluoroanilino)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H26FN3O6S/c1-4-15-28-26(32)19-9-5-7-11-21(19)29-25(31)17-30(22-12-8-6-10-20(22)27)37(33,34)18-13-14-23(35-2)24(16-18)36-3/h4-14,16H,1,15,17H2,2-3H3,(H,28,32)(H,29,31) |
| InChIKey | DDOLPSFBUCUWKU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|