C28H30F3N3O7S — CID 43900735
2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 43900735) has the molecular formula C28H30F3N3O7S and a molecular weight of 609.62 g/mol. Its IUPAC name is 2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 43900735 |
| Molecular Formula | C28H30F3N3O7S |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30F3N3O7S/c1-39-15-7-14-32-27(36)22-10-4-5-11-23(22)33-26(35)18-34(20-9-6-8-19(16-20)28(29,30)31)42(37,38)21-12-13-24(40-2)25(17-21)41-3/h4-6,8-13,16-17H,7,14-15,18H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | HFZKSSLSYRAESR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|