C24H24BrN3O5S — CID 126319908
2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 126319908) has the molecular formula C24H24BrN3O5S and a molecular weight of 546.44 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 126319908 |
| Molecular Formula | C24H24BrN3O5S |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1NC(=O)CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24BrN3O5S/c1-33-15-14-26-24(30)21-12-5-6-13-22(21)27-23(29)17-28(19-9-7-8-18(25)16-19)34(31,32)20-10-3-2-4-11-20/h2-13,16H,14-15,17H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | DCMHUSOHMWKXDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|