C25H24BrN3O4S — CID 126117050
2-[[2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 126117050) has the molecular formula C25H24BrN3O4S and a molecular weight of 542.46 g/mol. Its IUPAC name is 2-[[2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 126117050 |
| Molecular Formula | C25H24BrN3O4S |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 2-[[2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)CN(c1cccc(Br)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24BrN3O4S/c1-3-15-27-25(31)22-9-4-5-10-23(22)28-24(30)17-29(20-8-6-7-19(26)16-20)34(32,33)21-13-11-18(2)12-14-21/h3-14,16H,1,15,17H2,2H3,(H,27,31)(H,28,30) |
| InChIKey | YGPGKEGZFJLVDM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|