C30H29N3O5S — CID 126135286
2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 126135286) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 126135286 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | COc1cccc(N(CC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H29N3O5S/c1-38-25-14-10-13-24(21-25)33(39(36,37)26-15-6-3-7-16-26)22-29(34)32-28-18-9-8-17-27(28)30(35)31-20-19-23-11-4-2-5-12-23/h2-18,21H,19-20,22H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | QGPYGMFRFHFKMR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |