C22H30N4O6S2 — CID 30271289
N-butyl-2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]benzamide (PubChem CID 30271289) has the molecular formula C22H30N4O6S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-butyl-2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]benzamide.
| Compound Name | N-butyl-2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 30271289 |
| Molecular Formula | C22H30N4O6S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-butyl-2-[[2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H30N4O6S2/c1-5-6-15-23-22(28)19-9-7-8-10-20(19)24-21(27)16-26(33(4,29)30)17-11-13-18(14-12-17)34(31,32)25(2)3/h7-14H,5-6,15-16H2,1-4H3,(H,23,28)(H,24,27) |
| InChIKey | ZMNQBVIRVLJIDZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|