C20H23Cl2N3O4S — CID 21372765
N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]amino]benzamide (PubChem CID 21372765) has the molecular formula C20H23Cl2N3O4S and a molecular weight of 472.39 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 21372765 |
| Molecular Formula | C20H23Cl2N3O4S |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CN(c1cccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C20H23Cl2N3O4S/c1-3-4-12-23-20(27)14-8-5-6-10-16(14)24-18(26)13-25(30(2,28)29)17-11-7-9-15(21)19(17)22/h5-11H,3-4,12-13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | OYYISEUVGPUTCL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|