C19H20F2N2O2 — CID 110896199
1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 110896199) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110896199 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)NCC1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20F2N2O2/c20-15-5-1-13(2-6-15)17(24)11-22-18(25)23-12-19(9-10-19)14-3-7-16(21)8-4-14/h1-8,17,24H,9-12H2,(H2,22,23,25) |
| InChIKey | LYBDPNNNJIMUIO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |