C21H27FN2O4 — CID 86996503
1-[(4-butoxy-3-methoxyphenyl)methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 86996503) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 86996503 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | CCCCOc1ccc(CNC(=O)NCC(O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H27FN2O4/c1-3-4-11-28-19-10-5-15(12-20(19)27-2)13-23-21(26)24-14-18(25)16-6-8-17(22)9-7-16/h5-10,12,18,25H,3-4,11,13-14H2,1-2H3,(H2,23,24,26) |
| InChIKey | BXVHUNDSTMVZCR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|