C20H25NO3 — CID 122031405
3-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]amino]methyl]benzoic acid (PubChem CID 122031405) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031405 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]amino]methyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(O)CNCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-20(2,3)17-9-7-15(8-10-17)18(22)13-21-12-14-5-4-6-16(11-14)19(23)24/h4-11,18,21-22H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | JYYSJXUQIANGHG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |