C21H21NO3 — CID 143793936
3-[[(3-hydroxy-3-naphthalen-2-ylpropyl)amino]methyl]benzoic acid (PubChem CID 143793936) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-[[(3-hydroxy-3-naphthalen-2-ylpropyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(3-hydroxy-3-naphthalen-2-ylpropyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 143793936 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[[(3-hydroxy-3-naphthalen-2-ylpropyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCCC(O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C21H21NO3/c23-20(18-9-8-16-5-1-2-6-17(16)13-18)10-11-22-14-15-4-3-7-19(12-15)21(24)25/h1-9,12-13,20,22-23H,10-11,14H2,(H,24,25) |
| InChIKey | HAZNLDIFWIULPT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|