C20H34ClN5O — CID 111680720
2-[2-(4-chlorophenoxy)propyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 111680720) has the molecular formula C20H34ClN5O and a molecular weight of 395.98 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)propyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenoxy)propyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111680720 |
| Molecular Formula | C20H34ClN5O |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)propyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccc(Cl)cc1)NCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C20H34ClN5O/c1-4-22-20(23-10-13-26-12-5-11-25(3)14-15-26)24-16-17(2)27-19-8-6-18(21)7-9-19/h6-9,17H,4-5,10-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | DIGIIJHDACLBHP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|