C18H40IN5 — CID 111891726
1-ethyl-2-(2-ethylbutyl)-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111891726) has the molecular formula C18H40IN5 and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-ethyl-2-(2-ethylbutyl)-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-ethylbutyl)-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111891726 |
| Molecular Formula | C18H40IN5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-ethyl-2-(2-ethylbutyl)-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)CC)NCCCN1CCCN(C)CC1.I |
| InChI | InChI=1S/C18H39N5.HI/c1-5-17(6-2)16-21-18(19-7-3)20-10-8-12-23-13-9-11-22(4)14-15-23;/h17H,5-16H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | HKKJGOUIONVMOE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|