C24H42N6 — CID 111326074
1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111326074) has the molecular formula C24H42N6 and a molecular weight of 414.64 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326074 |
| Molecular Formula | C24H42N6 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCCC1)NCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C24H42N6/c1-3-25-24(26-13-7-8-14-29-19-17-28(2)18-20-29)27-21-23(30-15-9-10-16-30)22-11-5-4-6-12-22/h4-6,11-12,23H,3,7-10,13-21H2,1-2H3,(H2,25,26,27) |
| InChIKey | VQOPSHDFIAORNZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|