C24H39N5O — CID 111326888
1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111326888) has the molecular formula C24H39N5O and a molecular weight of 413.61 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326888 |
| Molecular Formula | C24H39N5O |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCCC1)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C24H39N5O/c1-2-25-24(26-15-11-19-29-18-8-4-7-14-23(29)30)27-20-22(28-16-9-10-17-28)21-12-5-3-6-13-21/h3,5-6,12-13,22H,2,4,7-11,14-20H2,1H3,(H2,25,26,27) |
| InChIKey | BBKKLFQOZMCZKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|