C24H35IN4O2S — CID 111325901
1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111325901) has the molecular formula C24H35IN4O2S and a molecular weight of 570.54 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111325901 |
| Molecular Formula | C24H35IN4O2S |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCCC1)NCCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C24H34N4O2S.HI/c1-2-25-24(26-16-11-19-31(29,30)22-14-7-4-8-15-22)27-20-23(28-17-9-10-18-28)21-12-5-3-6-13-21;/h3-8,12-15,23H,2,9-11,16-20H2,1H3,(H2,25,26,27);1H |
| InChIKey | RUPQUTCPJWFTAZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|