C23H34N4O3S — CID 111303913
1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine (PubChem CID 111303913) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111303913 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N1CCCCC1)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34N4O3S/c1-2-24-23(25-14-10-18-31(28,29)20-11-5-3-6-12-20)26-19-21(22-13-9-17-30-22)27-15-7-4-8-16-27/h3,5-6,9,11-13,17,21H,2,4,7-8,10,14-16,18-19H2,1H3,(H2,24,25,26) |
| InChIKey | NMTUWXXUGJLICM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|