C21H29FN4O3S — CID 111578445
1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111578445) has the molecular formula C21H29FN4O3S and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111578445 |
| Molecular Formula | C21H29FN4O3S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)sulfonylethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N1CCCC1)NCCS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C21H29FN4O3S/c1-2-23-21(24-11-15-30(27,28)20-10-4-3-8-17(20)22)25-16-18(19-9-7-14-29-19)26-12-5-6-13-26/h3-4,7-10,14,18H,2,5-6,11-13,15-16H2,1H3,(H2,23,24,25) |
| InChIKey | RZLBSAYJFRXKFL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|