C21H31IN4O2 — CID 109408035
1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 109408035) has the molecular formula C21H31IN4O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109408035 |
| Molecular Formula | C21H31IN4O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCCCn1ccccc1=O.I |
| InChI | InChI=1S/C21H30N4O2.HI/c1-2-22-21(24-16-19(17-26)18-10-4-3-5-11-18)23-13-7-9-15-25-14-8-6-12-20(25)27;/h3-6,8,10-12,14,19,26H,2,7,9,13,15-17H2,1H3,(H2,22,23,24);1H |
| InChIKey | RBXSWXMTIZJBEC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|