C18H32IN3O3S — CID 111986004
1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111986004) has the molecular formula C18H32IN3O3S and a molecular weight of 497.44 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111986004 |
| Molecular Formula | C18H32IN3O3S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCC(O)c1cc(OC)cc(OC)c1.I |
| InChI | InChI=1S/C18H31N3O3S.HI/c1-7-19-17(21-12-18(2,3)25-6)20-11-16(22)13-8-14(23-4)10-15(9-13)24-5;/h8-10,16,22H,7,11-12H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | BHFDMSLVOPXJPH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|