C18H26N4O3S — CID 111982421
1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111982421) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111982421 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H26N4O3S/c1-5-19-18(22-11-17-20-9-12(2)26-17)21-10-16(23)13-6-14(24-3)8-15(7-13)25-4/h6-9,16,23H,5,10-11H2,1-4H3,(H2,19,21,22) |
| InChIKey | QRHYTIDRTCXUFB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|