C20H29N3O3S — CID 111986633
1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-thiophen-2-ylpropyl)guanidine (PubChem CID 111986633) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111986633 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-(2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1cccs1)NCC(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C20H29N3O3S/c1-5-21-20(22-12-14(2)19-7-6-8-27-19)23-13-18(24)15-9-16(25-3)11-17(10-15)26-4/h6-11,14,18,24H,5,12-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | PUYJUWDGRDJDIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|