C17H20Cl2N4O3 — CID 109492710
5-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide (PubChem CID 109492710) has the molecular formula C17H20Cl2N4O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is 5-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 109492710 |
| Molecular Formula | C17H20Cl2N4O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 5-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)o1)NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4O3/c1-2-21-17(22-8-13-3-4-15(26-13)16(20)25)23-9-14(24)10-5-11(18)7-12(19)6-10/h3-7,14,24H,2,8-9H2,1H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | LPBQXPKIFAWRNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|