C17H22N4O2S — CID 111908621
5-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]furan-2-carboxamide (PubChem CID 111908621) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 5-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111908621 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 5-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)o1)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-19-17(20-10-11-24-14-6-4-3-5-7-14)21-12-13-8-9-15(23-13)16(18)22/h3-9H,2,10-12H2,1H3,(H2,18,22)(H2,19,20,21) |
| InChIKey | MANNVGIZQXFPPW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|