C18H22N4O4 — CID 111908639
5-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide (PubChem CID 111908639) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 5-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111908639 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)o1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H22N4O4/c1-2-20-18(22-10-13-4-6-15(26-13)17(19)23)21-8-7-12-3-5-14-16(9-12)25-11-24-14/h3-6,9H,2,7-8,10-11H2,1H3,(H2,19,23)(H2,20,21,22) |
| InChIKey | UHFKJKZASSSJNT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|