C21H26N4O4 — CID 111767551
2-[3-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111767551) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[3-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111767551 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[3-[[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H26N4O4/c1-2-23-21(24-9-8-15-6-7-18-19(11-15)29-14-28-18)25-12-16-4-3-5-17(10-16)27-13-20(22)26/h3-7,10-11H,2,8-9,12-14H2,1H3,(H2,22,26)(H2,23,24,25) |
| InChIKey | RIIQTALUKNKHLL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|