C20H23Cl2N5O — CID 109492782
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine (PubChem CID 109492782) has the molecular formula C20H23Cl2N5O and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109492782 |
| Molecular Formula | C20H23Cl2N5O |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cn2c(C)cccc2n1)NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2N5O/c1-3-23-20(25-11-18(28)14-7-15(21)9-16(22)8-14)24-10-17-12-27-13(2)5-4-6-19(27)26-17/h4-9,12,18,28H,3,10-11H2,1-2H3,(H2,23,24,25) |
| InChIKey | MEMLOJCCADPCJB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|