C15H23N5S2 — CID 86778954
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 86778954) has the molecular formula C15H23N5S2 and a molecular weight of 337.52 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 86778954 |
| Molecular Formula | C15H23N5S2 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCc1sccc1C |
| InChI | InChI=1S/C15H23N5S2/c1-5-16-14(18-9-13-11(2)6-7-21-13)17-8-12-10-22-15(19-12)20(3)4/h6-7,10H,5,8-9H2,1-4H3,(H2,16,17,18) |
| InChIKey | OJDSHUKDZZDPRF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|