C14H20IN5S — CID 111600820
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 111600820) has the molecular formula C14H20IN5S and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600820 |
| Molecular Formula | C14H20IN5S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/Cc2csc(N(C)C)n2)c1.I |
| InChI | InChI=1S/C14H19N5S.HI/c1-10-5-4-6-11(7-10)17-13(15)16-8-12-9-20-14(18-12)19(2)3;/h4-7,9H,8H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | PHWIFLHKKCHDIX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|