C18H22N4O — CID 111058801
3-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111058801) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111058801 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C/N=C(\N)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C18H22N4O/c1-12-7-8-16(9-13(12)2)22-18(19)21-11-14-5-4-6-15(10-14)17(23)20-3/h4-10H,11H2,1-3H3,(H,20,23)(H3,19,21,22) |
| InChIKey | ILHZUWDMHZHFSX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|