C16H27N5OS — CID 110963059
4-acetyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 110963059) has the molecular formula C16H27N5OS and a molecular weight of 337.49 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963059 |
| Molecular Formula | C16H27N5OS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1csc(CC)n1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H27N5OS/c1-4-15-19-14(12-23-15)6-7-18-16(17-5-2)21-10-8-20(9-11-21)13(3)22/h12H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | MKMRUYXACGQOOB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|