C16H26F3N5S — CID 109378335
N-ethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378335) has the molecular formula C16H26F3N5S and a molecular weight of 377.48 g/mol. Its IUPAC name is N-ethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378335 |
| Molecular Formula | C16H26F3N5S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-ethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1csc(CC)n1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H26F3N5S/c1-4-14-22-13(11-25-14)10-21-15(20-5-2)24-8-6-23(7-9-24)12(3)16(17,18)19/h11-12H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | YUEFNLQZCZAFAD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|