C19H26F3N5 — CID 109378824
N-ethyl-N'-(1H-indol-2-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378824) has the molecular formula C19H26F3N5 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-ethyl-N'-(1H-indol-2-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(1H-indol-2-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378824 |
| Molecular Formula | C19H26F3N5 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-ethyl-N'-(1H-indol-2-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H26F3N5/c1-3-23-18(24-13-16-12-15-6-4-5-7-17(15)25-16)27-10-8-26(9-11-27)14(2)19(20,21)22/h4-7,12,14,25H,3,8-11,13H2,1-2H3,(H,23,24) |
| InChIKey | YTRXZVVSXBALGK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|