C18H26N4S — CID 109486190
N,2-diethyl-N'-(1H-indol-2-ylmethyl)thiomorpholine-4-carboximidamide (PubChem CID 109486190) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is N,2-diethyl-N'-(1H-indol-2-ylmethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-(1H-indol-2-ylmethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486190 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N,2-diethyl-N'-(1H-indol-2-ylmethyl)thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C18H26N4S/c1-3-16-13-22(9-10-23-16)18(19-4-2)20-12-15-11-14-7-5-6-8-17(14)21-15/h5-8,11,16,21H,3-4,9-10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | PEUJJLFFUPPKDG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|