C21H31N5S — CID 110959917
4-benzyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 110959917) has the molecular formula C21H31N5S and a molecular weight of 385.58 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110959917 |
| Molecular Formula | C21H31N5S |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1csc(CC)n1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N5S/c1-3-20-24-19(17-27-20)10-11-23-21(22-4-2)26-14-12-25(13-15-26)16-18-8-6-5-7-9-18/h5-9,17H,3-4,10-16H2,1-2H3,(H,22,23) |
| InChIKey | QIFAUMRGRREUBN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|