C18H27N7OS — CID 109434229
N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109434229) has the molecular formula C18H27N7OS and a molecular weight of 389.53 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109434229 |
| Molecular Formula | C18H27N7OS |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-ethyl-N'-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1csc(CC)n1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H27N7OS/c1-4-16-22-14(13-27-16)6-7-20-18(19-5-2)24-8-9-25(17(26)12-24)15-10-21-23(3)11-15/h10-11,13H,4-9,12H2,1-3H3,(H,19,20) |
| InChIKey | ZYVHVUUOFLEWJX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|