C19H34N4O2S2 — CID 111740118
N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide (PubChem CID 111740118) has the molecular formula C19H34N4O2S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111740118 |
| Molecular Formula | C19H34N4O2S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(S(=O)(=O)N(CC)CC)s1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C19H34N4O2S2/c1-6-20-18(22-14-12-19(4,5)15-22)21-13-11-16-9-10-17(26-16)27(24,25)23(7-2)8-3/h9-10H,6-8,11-15H2,1-5H3,(H,20,21) |
| InChIKey | QRNKSXWUXRQLHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|