C15H28N4O2S2 — CID 111101475
1-tert-butyl-2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]guanidine (PubChem CID 111101475) has the molecular formula C15H28N4O2S2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111101475 |
| Molecular Formula | C15H28N4O2S2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-tert-butyl-2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]guanidine |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CC/N=C(\N)NC(C)(C)C)s1 |
| InChI | InChI=1S/C15H28N4O2S2/c1-6-19(7-2)23(20,21)13-9-8-12(22-13)10-11-17-14(16)18-15(3,4)5/h8-9H,6-7,10-11H2,1-5H3,(H3,16,17,18) |
| InChIKey | YECCYHOXIQEWKW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|