C12H22IN3O2S2 — CID 120662455
1-tert-butyl-2-[(5-ethylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 120662455) has the molecular formula C12H22IN3O2S2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 1-tert-butyl-2-[(5-ethylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[(5-ethylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120662455 |
| Molecular Formula | C12H22IN3O2S2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 1-tert-butyl-2-[(5-ethylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)c1ccc(C/N=C(\N)NC(C)(C)C)s1.I |
| InChI | InChI=1S/C12H21N3O2S2.HI/c1-5-19(16,17)10-7-6-9(18-10)8-14-11(13)15-12(2,3)4;/h6-7H,5,8H2,1-4H3,(H3,13,14,15);1H |
| InChIKey | MGSXEJPIXDLRDU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|