C14H18IN3S — CID 110925540
2-[(5-ethylthiophen-2-yl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110925540) has the molecular formula C14H18IN3S and a molecular weight of 387.29 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(5-ethylthiophen-2-yl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110925540 |
| Molecular Formula | C14H18IN3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | CCc1ccc(C/N=C(\N)Nc2ccccc2)s1.I |
| InChI | InChI=1S/C14H17N3S.HI/c1-2-12-8-9-13(18-12)10-16-14(15)17-11-6-4-3-5-7-11;/h3-9H,2,10H2,1H3,(H3,15,16,17);1H |
| InChIKey | JBUSUFQOSQFUIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|