C14H16BrN3S — CID 111066974
2-[(5-bromothiophen-2-yl)methyl]-1-(3-ethylphenyl)guanidine (PubChem CID 111066974) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-(3-ethylphenyl)guanidine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-(3-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 111066974 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-(3-ethylphenyl)guanidine |
| SMILES | CCc1cccc(N/C(N)=N/Cc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H16BrN3S/c1-2-10-4-3-5-11(8-10)18-14(16)17-9-12-6-7-13(15)19-12/h3-8H,2,9H2,1H3,(H3,16,17,18) |
| InChIKey | JIVYSPBLTBCBHS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|