C18H23N3O2S2 — CID 120662474
2-[(5-ethylsulfonylthiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 120662474) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 2-[(5-ethylsulfonylthiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[(5-ethylsulfonylthiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 120662474 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[(5-ethylsulfonylthiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | CCS(=O)(=O)c1ccc(C/N=C(\N)Nc2cccc3c2CCCC3)s1 |
| InChI | InChI=1S/C18H23N3O2S2/c1-2-25(22,23)17-11-10-14(24-17)12-20-18(19)21-16-9-5-7-13-6-3-4-8-15(13)16/h5,7,9-11H,2-4,6,8,12H2,1H3,(H3,19,20,21) |
| InChIKey | JJMUGTWPQQZLHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|