C19H28N4O4S2 — CID 111101497
2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine (PubChem CID 111101497) has the molecular formula C19H28N4O4S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine.
| Compound Name | 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111101497 |
| Molecular Formula | C19H28N4O4S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CC/N=C(\N)Nc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C19H28N4O4S2/c1-5-23(6-2)29(24,25)18-10-8-15(28-18)11-12-21-19(20)22-14-7-9-16(26-3)17(13-14)27-4/h7-10,13H,5-6,11-12H2,1-4H3,(H3,20,21,22) |
| InChIKey | OLXYUTOFWYAIIL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|