C19H31N5O3S2 — CID 111586865
1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586865) has the molecular formula C19H31N5O3S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586865 |
| Molecular Formula | C19H31N5O3S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCN/C(=N/C)NCc2cc(C(C)C)no2)s1 |
| InChI | InChI=1S/C19H31N5O3S2/c1-6-24(7-2)29(25,26)18-9-8-16(28-18)10-11-21-19(20-5)22-13-15-12-17(14(3)4)23-27-15/h8-9,12,14H,6-7,10-11,13H2,1-5H3,(H2,20,21,22) |
| InChIKey | MQVWEGBVAWDZFY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|