C17H30BrIN4O2S — CID 111657965
1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111657965) has the molecular formula C17H30BrIN4O2S and a molecular weight of 561.33 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111657965 |
| Molecular Formula | C17H30BrIN4O2S |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCc1ccc(Br)s1.I |
| InChI | InChI=1S/C17H29BrN4O2S.HI/c1-3-19-16(20-7-6-14-4-5-15(18)25-14)21-12-17(2,23)13-22-8-10-24-11-9-22;/h4-5,23H,3,6-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | VNMHFYKWSYDODB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|