C21H35N5O3 — CID 111657842
N-benzyl-3-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]propanamide (PubChem CID 111657842) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-benzyl-3-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-benzyl-3-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111657842 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | N-benzyl-3-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H35N5O3/c1-3-22-20(25-16-21(2,28)17-26-11-13-29-14-12-26)23-10-9-19(27)24-15-18-7-5-4-6-8-18/h4-8,28H,3,9-17H2,1-2H3,(H,24,27)(H2,22,23,25) |
| InChIKey | XISOQGOWBMGKFV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|