C16H22BrFN4O — CID 111928402
N-[2-[[N'-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111928402) has the molecular formula C16H22BrFN4O and a molecular weight of 385.28 g/mol. Its IUPAC name is N-[2-[[N'-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111928402 |
| Molecular Formula | C16H22BrFN4O |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[2-[[N'-[(3-bromo-5-fluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\Cc1cc(F)cc(Br)c1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C16H22BrFN4O/c1-2-19-16(21-6-5-20-15(23)12-3-4-12)22-10-11-7-13(17)9-14(18)8-11/h7-9,12H,2-6,10H2,1H3,(H,20,23)(H2,19,21,22) |
| InChIKey | AULMINCSPJVFSS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|